C19H29N3O4S4Zn — CID 87493196
zinc;propan-2-yl N-(3,4-diethoxyphenyl)carbamate;N-[1-(sulfidocarbothioylamino)propan-2-yl]carbamodithioate (PubChem CID 87493196) has the molecular formula C19H29N3O4S4Zn and a molecular weight of 557.12 g/mol. Its IUPAC name is zinc;propan-2-yl N-(3,4-diethoxyphenyl)carbamate;N-[1-(sulfidocarbothioylamino)propan-2-yl]carbamodithioate.
| Compound Name | zinc;propan-2-yl N-(3,4-diethoxyphenyl)carbamate;N-[1-(sulfidocarbothioylamino)propan-2-yl]carbamodithioate |
|---|---|
| PubChem CID | 87493196 |
| Molecular Formula | C19H29N3O4S4Zn |
| Molecular Weight | 557.12 g/mol |
| Exact Mass | 555.03 |
| IUPAC Name | zinc;propan-2-yl N-(3,4-diethoxyphenyl)carbamate;N-[1-(sulfidocarbothioylamino)propan-2-yl]carbamodithioate |
| SMILES | CC(CNC(=S)[S-])NC(=S)[S-].CCOc1ccc(NC(=O)OC(C)C)cc1OCC.[Zn+2] |
| InChI | InChI=1S/C14H21NO4.C5H10N2S4.Zn/c1-5-17-12-8-7-11(9-13(12)18-6-2)15-14(16)19-10(3)4;1-3(7-5(10)11)2-6-4(8)9;/h7-10H,5-6H2,1-4H3,(H,15,16);3H,2H2,1H3,(H2,6,8,9)(H2,7,10,11);/q;;+2/p-2 |
| InChIKey | OFDVMRNLFMMAJD-UHFFFAOYSA-L |
| XLogP | 3.66 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.12 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|