C14H19Br2NO4 — CID 13421201
1,3-dibromopropan-2-yl N-(3,4-diethoxyphenyl)carbamate (PubChem CID 13421201) has the molecular formula C14H19Br2NO4 and a molecular weight of 425.12 g/mol. Its IUPAC name is 1,3-dibromopropan-2-yl N-(3,4-diethoxyphenyl)carbamate.
| Compound Name | 1,3-dibromopropan-2-yl N-(3,4-diethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 13421201 |
| Molecular Formula | C14H19Br2NO4 |
| Molecular Weight | 425.12 g/mol |
| Exact Mass | 422.97 |
| IUPAC Name | 1,3-dibromopropan-2-yl N-(3,4-diethoxyphenyl)carbamate |
| SMILES | CCOc1ccc(NC(=O)OC(CBr)CBr)cc1OCC |
| InChI | InChI=1S/C14H19Br2NO4/c1-3-19-12-6-5-10(7-13(12)20-4-2)17-14(18)21-11(8-15)9-16/h5-7,11H,3-4,8-9H2,1-2H3,(H,17,18) |
| InChIKey | ZZSDDLHPHNWAHY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.12 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|