C13H15F4NO3 — CID 103731975
N-(3,4-diethoxyphenyl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103731975) has the molecular formula C13H15F4NO3 and a molecular weight of 309.26 g/mol. Its IUPAC name is N-(3,4-diethoxyphenyl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(3,4-diethoxyphenyl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103731975 |
| Molecular Formula | C13H15F4NO3 |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N-(3,4-diethoxyphenyl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | CCOc1ccc(NC(=O)C(F)(F)C(F)F)cc1OCC |
| InChI | InChI=1S/C13H15F4NO3/c1-3-20-9-6-5-8(7-10(9)21-4-2)18-12(19)13(16,17)11(14)15/h5-7,11H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | BPBSCKRZBPFIIW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|