C10H11ClF4N2O2 — CID 119419546
N-(3-amino-4-methoxyphenyl)-2,2,3,3-tetrafluoropropanamide;hydrochloride (PubChem CID 119419546) has the molecular formula C10H11ClF4N2O2 and a molecular weight of 302.66 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-2,2,3,3-tetrafluoropropanamide;hydrochloride.
| Compound Name | N-(3-amino-4-methoxyphenyl)-2,2,3,3-tetrafluoropropanamide;hydrochloride |
|---|---|
| PubChem CID | 119419546 |
| Molecular Formula | C10H11ClF4N2O2 |
| Molecular Weight | 302.66 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-2,2,3,3-tetrafluoropropanamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)C(F)(F)C(F)F)cc1N.Cl |
| InChI | InChI=1S/C10H10F4N2O2.ClH/c1-18-7-3-2-5(4-6(7)15)16-9(17)10(13,14)8(11)12;/h2-4,8H,15H2,1H3,(H,16,17);1H |
| InChIKey | OCYWBTVOQNAYCV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.66 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|