C11H11F4NO3 — CID 103731911
N-(3,5-dimethoxyphenyl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103731911) has the molecular formula C11H11F4NO3 and a molecular weight of 281.21 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103731911 |
| Molecular Formula | C11H11F4NO3 |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | COc1cc(NC(=O)C(F)(F)C(F)F)cc(OC)c1 |
| InChI | InChI=1S/C11H11F4NO3/c1-18-7-3-6(4-8(5-7)19-2)16-10(17)11(14,15)9(12)13/h3-5,9H,1-2H3,(H,16,17) |
| InChIKey | LAKSEBLHTKRFIM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|