C10H13NO3 — CID 702039
N-(3,5-dimethoxyphenyl)acetamide (PubChem CID 702039) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)acetamide.
| Compound Name | N-(3,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 702039 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(C)=O)cc(OC)c1 |
| InChI | InChI=1S/C10H13NO3/c1-7(12)11-8-4-9(13-2)6-10(5-8)14-3/h4-6H,1-3H3,(H,11,12) |
| InChIKey | OKOWOYJLYGCVSF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |