C10H13NO3S — CID 2971820
N-(3,5-dimethoxyphenyl)-2-sulfanylacetamide (PubChem CID 2971820) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2-sulfanylacetamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2-sulfanylacetamide |
|---|---|
| PubChem CID | 2971820 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2-sulfanylacetamide |
| SMILES | COc1cc(NC(=O)CS)cc(OC)c1 |
| InChI | InChI=1S/C10H13NO3S/c1-13-8-3-7(11-10(12)6-15)4-9(5-8)14-2/h3-5,15H,6H2,1-2H3,(H,11,12) |
| InChIKey | JPBVBXYAXLUKKO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|