C15H22N2O5 — CID 119994299
4-[[2-(3,5-dimethoxyanilino)-2-oxoethyl]-methylamino]butanoic acid (PubChem CID 119994299) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is 4-[[2-(3,5-dimethoxyanilino)-2-oxoethyl]-methylamino]butanoic acid.
| Compound Name | 4-[[2-(3,5-dimethoxyanilino)-2-oxoethyl]-methylamino]butanoic acid |
|---|---|
| PubChem CID | 119994299 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 4-[[2-(3,5-dimethoxyanilino)-2-oxoethyl]-methylamino]butanoic acid |
| SMILES | COc1cc(NC(=O)CN(C)CCCC(=O)O)cc(OC)c1 |
| InChI | InChI=1S/C15H22N2O5/c1-17(6-4-5-15(19)20)10-14(18)16-11-7-12(21-2)9-13(8-11)22-3/h7-9H,4-6,10H2,1-3H3,(H,16,18)(H,19,20) |
| InChIKey | YOICMZHHSHYOFA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |