C16H28N2O2 — CID 145342078
N-(4-methoxyphenyl)-2-[methyl(propyl)amino]acetamide;propane (PubChem CID 145342078) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[methyl(propyl)amino]acetamide;propane.
| Compound Name | N-(4-methoxyphenyl)-2-[methyl(propyl)amino]acetamide;propane |
|---|---|
| PubChem CID | 145342078 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[methyl(propyl)amino]acetamide;propane |
| SMILES | CCC.CCCN(C)CC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C13H20N2O2.C3H8/c1-4-9-15(2)10-13(16)14-11-5-7-12(17-3)8-6-11;1-3-2/h5-8H,4,9-10H2,1-3H3,(H,14,16);3H2,1-2H3 |
| InChIKey | GZUHKBRYSZYIHP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |