C14H22N2O2 — CID 3574765
3-(4-methoxyphenyl)-1,1-dipropylurea (PubChem CID 3574765) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1,1-dipropylurea.
| Compound Name | 3-(4-methoxyphenyl)-1,1-dipropylurea |
|---|---|
| PubChem CID | 3574765 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 3-(4-methoxyphenyl)-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H22N2O2/c1-4-10-16(11-5-2)14(17)15-12-6-8-13(18-3)9-7-12/h6-9H,4-5,10-11H2,1-3H3,(H,15,17) |
| InChIKey | YPGLDRUMWWCCIQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |