C16H27N3O — CID 61339464
3-[4-[1-(methylamino)ethyl]phenyl]-1,1-dipropylurea (PubChem CID 61339464) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 3-[4-[1-(methylamino)ethyl]phenyl]-1,1-dipropylurea.
| Compound Name | 3-[4-[1-(methylamino)ethyl]phenyl]-1,1-dipropylurea |
|---|---|
| PubChem CID | 61339464 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 3-[4-[1-(methylamino)ethyl]phenyl]-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)Nc1ccc(C(C)NC)cc1 |
| InChI | InChI=1S/C16H27N3O/c1-5-11-19(12-6-2)16(20)18-15-9-7-14(8-10-15)13(3)17-4/h7-10,13,17H,5-6,11-12H2,1-4H3,(H,18,20) |
| InChIKey | WROOIPAKNQVPAU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |