C27H40N4O2 — CID 3593543
3-[4-[[4-(dipropylcarbamoylamino)phenyl]methyl]phenyl]-1,1-dipropylurea (PubChem CID 3593543) has the molecular formula C27H40N4O2 and a molecular weight of 452.64 g/mol. Its IUPAC name is 3-[4-[[4-(dipropylcarbamoylamino)phenyl]methyl]phenyl]-1,1-dipropylurea.
| Compound Name | 3-[4-[[4-(dipropylcarbamoylamino)phenyl]methyl]phenyl]-1,1-dipropylurea |
|---|---|
| PubChem CID | 3593543 |
| Molecular Formula | C27H40N4O2 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.32 |
| IUPAC Name | 3-[4-[[4-(dipropylcarbamoylamino)phenyl]methyl]phenyl]-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)Nc1ccc(Cc2ccc(NC(=O)N(CCC)CCC)cc2)cc1 |
| InChI | InChI=1S/C27H40N4O2/c1-5-17-30(18-6-2)26(32)28-24-13-9-22(10-14-24)21-23-11-15-25(16-12-23)29-27(33)31(19-7-3)20-8-4/h9-16H,5-8,17-21H2,1-4H3,(H,28,32)(H,29,33) |
| InChIKey | YFUXBUHMBVFCFE-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |