C12H19N3O — CID 43133027
3-[4-(aminomethyl)phenyl]-1,1-diethylurea (PubChem CID 43133027) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-[4-(aminomethyl)phenyl]-1,1-diethylurea.
| Compound Name | 3-[4-(aminomethyl)phenyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 43133027 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 3-[4-(aminomethyl)phenyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1ccc(CN)cc1 |
| InChI | InChI=1S/C12H19N3O/c1-3-15(4-2)12(16)14-11-7-5-10(9-13)6-8-11/h5-8H,3-4,9,13H2,1-2H3,(H,14,16) |
| InChIKey | QNBFFOXPDONIMW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |