C11H16BrN3O — CID 79767901
3-(3-amino-4-bromophenyl)-1,1-diethylurea (PubChem CID 79767901) has the molecular formula C11H16BrN3O and a molecular weight of 286.17 g/mol. Its IUPAC name is 3-(3-amino-4-bromophenyl)-1,1-diethylurea.
| Compound Name | 3-(3-amino-4-bromophenyl)-1,1-diethylurea |
|---|---|
| PubChem CID | 79767901 |
| Molecular Formula | C11H16BrN3O |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 3-(3-amino-4-bromophenyl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1ccc(Br)c(N)c1 |
| InChI | InChI=1S/C11H16BrN3O/c1-3-15(4-2)11(16)14-8-5-6-9(12)10(13)7-8/h5-7H,3-4,13H2,1-2H3,(H,14,16) |
| InChIKey | SWYJZDDUQIMAPO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|