C11H17N3O2 — CID 107698052
3-(2-amino-4-hydroxyphenyl)-1,1-diethylurea (PubChem CID 107698052) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 3-(2-amino-4-hydroxyphenyl)-1,1-diethylurea.
| Compound Name | 3-(2-amino-4-hydroxyphenyl)-1,1-diethylurea |
|---|---|
| PubChem CID | 107698052 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 3-(2-amino-4-hydroxyphenyl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1ccc(O)cc1N |
| InChI | InChI=1S/C11H17N3O2/c1-3-14(4-2)11(16)13-10-6-5-8(15)7-9(10)12/h5-7,15H,3-4,12H2,1-2H3,(H,13,16) |
| InChIKey | KPQWDINJDBRMKH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|