C13H19BrN2O — CID 81003513
3-(4-bromo-2-ethylphenyl)-1,1-diethylurea (PubChem CID 81003513) has the molecular formula C13H19BrN2O and a molecular weight of 299.21 g/mol. Its IUPAC name is 3-(4-bromo-2-ethylphenyl)-1,1-diethylurea.
| Compound Name | 3-(4-bromo-2-ethylphenyl)-1,1-diethylurea |
|---|---|
| PubChem CID | 81003513 |
| Molecular Formula | C13H19BrN2O |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 3-(4-bromo-2-ethylphenyl)-1,1-diethylurea |
| SMILES | CCc1cc(Br)ccc1NC(=O)N(CC)CC |
| InChI | InChI=1S/C13H19BrN2O/c1-4-10-9-11(14)7-8-12(10)15-13(17)16(5-2)6-3/h7-9H,4-6H2,1-3H3,(H,15,17) |
| InChIKey | IOILWPIPXUTDJY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |