C12H17BrN2O2 — CID 60562444
3-(5-bromo-2-methoxyphenyl)-1,1-diethylurea (PubChem CID 60562444) has the molecular formula C12H17BrN2O2 and a molecular weight of 301.18 g/mol. Its IUPAC name is 3-(5-bromo-2-methoxyphenyl)-1,1-diethylurea.
| Compound Name | 3-(5-bromo-2-methoxyphenyl)-1,1-diethylurea |
|---|---|
| PubChem CID | 60562444 |
| Molecular Formula | C12H17BrN2O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 3-(5-bromo-2-methoxyphenyl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1cc(Br)ccc1OC |
| InChI | InChI=1S/C12H17BrN2O2/c1-4-15(5-2)12(16)14-10-8-9(13)6-7-11(10)17-3/h6-8H,4-5H2,1-3H3,(H,14,16) |
| InChIKey | VNZUHVPVCQTGBX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |