C15H16BrClN2O2S — CID 60562828
3-(5-bromo-2-methoxyphenyl)-1-[(5-chlorothiophen-2-yl)methyl]-1-ethylurea (PubChem CID 60562828) has the molecular formula C15H16BrClN2O2S and a molecular weight of 403.73 g/mol. Its IUPAC name is 3-(5-bromo-2-methoxyphenyl)-1-[(5-chlorothiophen-2-yl)methyl]-1-ethylurea.
| Compound Name | 3-(5-bromo-2-methoxyphenyl)-1-[(5-chlorothiophen-2-yl)methyl]-1-ethylurea |
|---|---|
| PubChem CID | 60562828 |
| Molecular Formula | C15H16BrClN2O2S |
| Molecular Weight | 403.73 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | 3-(5-bromo-2-methoxyphenyl)-1-[(5-chlorothiophen-2-yl)methyl]-1-ethylurea |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)Nc1cc(Br)ccc1OC |
| InChI | InChI=1S/C15H16BrClN2O2S/c1-3-19(9-11-5-7-14(17)22-11)15(20)18-12-8-10(16)4-6-13(12)21-2/h4-8H,3,9H2,1-2H3,(H,18,20) |
| InChIKey | XJKUKVOWBBKLOZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.73 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |