C16H18ClNO3S — CID 78788909
N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2,5-dimethoxybenzamide (PubChem CID 78788909) has the molecular formula C16H18ClNO3S and a molecular weight of 339.84 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2,5-dimethoxybenzamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 78788909 |
| Molecular Formula | C16H18ClNO3S |
| Molecular Weight | 339.84 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2,5-dimethoxybenzamide |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C16H18ClNO3S/c1-4-18(10-12-6-8-15(17)22-12)16(19)13-9-11(20-2)5-7-14(13)21-3/h5-9H,4,10H2,1-3H3 |
| InChIKey | VPTDYGNODOFMHS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.84 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |