C12H13ClN2OS2 — CID 61116379
3-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylthiophene-2-carboxamide (PubChem CID 61116379) has the molecular formula C12H13ClN2OS2 and a molecular weight of 300.84 g/mol. Its IUPAC name is 3-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylthiophene-2-carboxamide.
| Compound Name | 3-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 61116379 |
| Molecular Formula | C12H13ClN2OS2 |
| Molecular Weight | 300.84 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 3-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylthiophene-2-carboxamide |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)c1sccc1N |
| InChI | InChI=1S/C12H13ClN2OS2/c1-2-15(7-8-3-4-10(13)18-8)12(16)11-9(14)5-6-17-11/h3-6H,2,7,14H2,1H3 |
| InChIKey | NYWXUHPCSBHZTI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.84 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |