C14H16ClN3OS — CID 61116550
3,5-diamino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylbenzamide (PubChem CID 61116550) has the molecular formula C14H16ClN3OS and a molecular weight of 309.82 g/mol. Its IUPAC name is 3,5-diamino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylbenzamide.
| Compound Name | 3,5-diamino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 61116550 |
| Molecular Formula | C14H16ClN3OS |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3,5-diamino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylbenzamide |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C14H16ClN3OS/c1-2-18(8-12-3-4-13(15)20-12)14(19)9-5-10(16)7-11(17)6-9/h3-7H,2,8,16-17H2,1H3 |
| InChIKey | UMVIAZPJJKEEOF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|