C18H20ClNO5S — CID 119179644
2-[4-[(5-chlorothiophen-2-yl)methyl-ethylcarbamoyl]-2-ethoxyphenoxy]acetic acid (PubChem CID 119179644) has the molecular formula C18H20ClNO5S and a molecular weight of 397.88 g/mol. Its IUPAC name is 2-[4-[(5-chlorothiophen-2-yl)methyl-ethylcarbamoyl]-2-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(5-chlorothiophen-2-yl)methyl-ethylcarbamoyl]-2-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 119179644 |
| Molecular Formula | C18H20ClNO5S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-[4-[(5-chlorothiophen-2-yl)methyl-ethylcarbamoyl]-2-ethoxyphenoxy]acetic acid |
| SMILES | CCOc1cc(C(=O)N(CC)Cc2ccc(Cl)s2)ccc1OCC(=O)O |
| InChI | InChI=1S/C18H20ClNO5S/c1-3-20(10-13-6-8-16(19)26-13)18(23)12-5-7-14(25-11-17(21)22)15(9-12)24-4-2/h5-9H,3-4,10-11H2,1-2H3,(H,21,22) |
| InChIKey | KQVMXBVPQDSTQN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |