C18H23NO3S — CID 78801031
3,4-diethoxy-N-ethyl-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 78801031) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is 3,4-diethoxy-N-ethyl-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 3,4-diethoxy-N-ethyl-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 78801031 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 3,4-diethoxy-N-ethyl-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | CCOc1ccc(C(=O)N(CC)Cc2cccs2)cc1OCC |
| InChI | InChI=1S/C18H23NO3S/c1-4-19(13-15-8-7-11-23-15)18(20)14-9-10-16(21-5-2)17(12-14)22-6-3/h7-12H,4-6,13H2,1-3H3 |
| InChIKey | OKSCOPHWXBBRCG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |