C25H29NO5S — CID 27863365
4-ethoxy-N-ethyl-3-methoxy-N-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]benzamide (PubChem CID 27863365) has the molecular formula C25H29NO5S and a molecular weight of 455.58 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-3-methoxy-N-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]benzamide.
| Compound Name | 4-ethoxy-N-ethyl-3-methoxy-N-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 27863365 |
| Molecular Formula | C25H29NO5S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 4-ethoxy-N-ethyl-3-methoxy-N-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]benzamide |
| SMILES | CCOc1ccc(C(=O)N(CC)Cc2ccc(OCc3cccs3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C25H29NO5S/c1-5-26(25(27)19-10-12-21(30-6-2)24(15-19)29-4)16-18-9-11-22(23(14-18)28-3)31-17-20-8-7-13-32-20/h7-15H,5-6,16-17H2,1-4H3 |
| InChIKey | RIWNXLGIOYOKIR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |