C20H28N2O3S — CID 119271670
2-amino-N-ethyl-N-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]pentanamide (PubChem CID 119271670) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is 2-amino-N-ethyl-N-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]pentanamide.
| Compound Name | 2-amino-N-ethyl-N-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 119271670 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-amino-N-ethyl-N-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]pentanamide |
| SMILES | CCCC(N)C(=O)N(CC)Cc1ccc(OCc2cccs2)c(OC)c1 |
| InChI | InChI=1S/C20H28N2O3S/c1-4-7-17(21)20(23)22(5-2)13-15-9-10-18(19(12-15)24-3)25-14-16-8-6-11-26-16/h6,8-12,17H,4-5,7,13-14,21H2,1-3H3 |
| InChIKey | HVXLODYTQWEWAW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |