C23H26N2O3S — CID 17468464
4-[[ethyl-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]amino]methyl]benzamide (PubChem CID 17468464) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 4-[[ethyl-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]amino]methyl]benzamide.
| Compound Name | 4-[[ethyl-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 17468464 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4-[[ethyl-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]amino]methyl]benzamide |
| SMILES | CCN(Cc1ccc(C(N)=O)cc1)Cc1ccc(OCc2cccs2)c(OC)c1 |
| InChI | InChI=1S/C23H26N2O3S/c1-3-25(14-17-6-9-19(10-7-17)23(24)26)15-18-8-11-21(22(13-18)27-2)28-16-20-5-4-12-29-20/h4-13H,3,14-16H2,1-2H3,(H2,24,26) |
| InChIKey | NDDXKMATVIVFLM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |