C18H25NO6 — CID 119182463
2-[2-ethoxy-4-[ethyl(oxolan-2-ylmethyl)carbamoyl]phenoxy]acetic acid (PubChem CID 119182463) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[ethyl(oxolan-2-ylmethyl)carbamoyl]phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-4-[ethyl(oxolan-2-ylmethyl)carbamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119182463 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-[2-ethoxy-4-[ethyl(oxolan-2-ylmethyl)carbamoyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(C(=O)N(CC)CC2CCCO2)ccc1OCC(=O)O |
| InChI | InChI=1S/C18H25NO6/c1-3-19(11-14-6-5-9-24-14)18(22)13-7-8-15(25-12-17(20)21)16(10-13)23-4-2/h7-8,10,14H,3-6,9,11-12H2,1-2H3,(H,20,21) |
| InChIKey | DWNAZBFZPHZTQC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |