C17H23NO6 — CID 119180117
2-[2-ethoxy-4-[2-(oxolan-2-yl)ethylcarbamoyl]phenoxy]acetic acid (PubChem CID 119180117) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[2-(oxolan-2-yl)ethylcarbamoyl]phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-4-[2-(oxolan-2-yl)ethylcarbamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119180117 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-[2-ethoxy-4-[2-(oxolan-2-yl)ethylcarbamoyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(C(=O)NCCC2CCCO2)ccc1OCC(=O)O |
| InChI | InChI=1S/C17H23NO6/c1-2-22-15-10-12(5-6-14(15)24-11-16(19)20)17(21)18-8-7-13-4-3-9-23-13/h5-6,10,13H,2-4,7-9,11H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | TZJDNGKBSMPUHP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |