C16H21NO6 — CID 122135254
2-[2-ethoxy-4-(oxan-4-ylcarbamoyl)phenoxy]acetic acid (PubChem CID 122135254) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-[2-ethoxy-4-(oxan-4-ylcarbamoyl)phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-4-(oxan-4-ylcarbamoyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 122135254 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-[2-ethoxy-4-(oxan-4-ylcarbamoyl)phenoxy]acetic acid |
| SMILES | CCOc1cc(C(=O)NC2CCOCC2)ccc1OCC(=O)O |
| InChI | InChI=1S/C16H21NO6/c1-2-22-14-9-11(3-4-13(14)23-10-15(18)19)16(20)17-12-5-7-21-8-6-12/h3-4,9,12H,2,5-8,10H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | OXZIEPPPGDYOCW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |