C17H22N2O6 — CID 119185113
2-[2-ethoxy-4-[(1-methyl-6-oxopiperidin-3-yl)carbamoyl]phenoxy]acetic acid (PubChem CID 119185113) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(1-methyl-6-oxopiperidin-3-yl)carbamoyl]phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-4-[(1-methyl-6-oxopiperidin-3-yl)carbamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119185113 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-[2-ethoxy-4-[(1-methyl-6-oxopiperidin-3-yl)carbamoyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(C(=O)NC2CCC(=O)N(C)C2)ccc1OCC(=O)O |
| InChI | InChI=1S/C17H22N2O6/c1-3-24-14-8-11(4-6-13(14)25-10-16(21)22)17(23)18-12-5-7-15(20)19(2)9-12/h4,6,8,12H,3,5,7,9-10H2,1-2H3,(H,18,23)(H,21,22) |
| InChIKey | XQYWYOMBXQTBHK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |