C21H31NO6 — CID 119186015
2-[4-[(2-tert-butyloxan-3-yl)methylcarbamoyl]-2-ethoxyphenoxy]acetic acid (PubChem CID 119186015) has the molecular formula C21H31NO6 and a molecular weight of 393.48 g/mol. Its IUPAC name is 2-[4-[(2-tert-butyloxan-3-yl)methylcarbamoyl]-2-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(2-tert-butyloxan-3-yl)methylcarbamoyl]-2-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 119186015 |
| Molecular Formula | C21H31NO6 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 2-[4-[(2-tert-butyloxan-3-yl)methylcarbamoyl]-2-ethoxyphenoxy]acetic acid |
| SMILES | CCOc1cc(C(=O)NCC2CCCOC2C(C)(C)C)ccc1OCC(=O)O |
| InChI | InChI=1S/C21H31NO6/c1-5-26-17-11-14(8-9-16(17)28-13-18(23)24)20(25)22-12-15-7-6-10-27-19(15)21(2,3)4/h8-9,11,15,19H,5-7,10,12-13H2,1-4H3,(H,22,25)(H,23,24) |
| InChIKey | RZXOGNMESPLYGV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |