C25H34N2O4 — CID 86972106
N-[(2-tert-butyloxan-3-yl)methyl]-3-ethoxy-4-(pyridin-4-ylmethoxy)benzamide (PubChem CID 86972106) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-[(2-tert-butyloxan-3-yl)methyl]-3-ethoxy-4-(pyridin-4-ylmethoxy)benzamide.
| Compound Name | N-[(2-tert-butyloxan-3-yl)methyl]-3-ethoxy-4-(pyridin-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 86972106 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | N-[(2-tert-butyloxan-3-yl)methyl]-3-ethoxy-4-(pyridin-4-ylmethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)NCC2CCCOC2C(C)(C)C)ccc1OCc1ccncc1 |
| InChI | InChI=1S/C25H34N2O4/c1-5-29-22-15-19(8-9-21(22)31-17-18-10-12-26-13-11-18)24(28)27-16-20-7-6-14-30-23(20)25(2,3)4/h8-13,15,20,23H,5-7,14,16-17H2,1-4H3,(H,27,28) |
| InChIKey | SWRVYIFOVYYGIF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |