C16H17Cl2NO3S — CID 112811138
3-chloro-N-[(5-chlorothiophen-2-yl)methyl]-5-ethoxy-N-ethyl-4-hydroxybenzamide (PubChem CID 112811138) has the molecular formula C16H17Cl2NO3S and a molecular weight of 374.29 g/mol. Its IUPAC name is 3-chloro-N-[(5-chlorothiophen-2-yl)methyl]-5-ethoxy-N-ethyl-4-hydroxybenzamide.
| Compound Name | 3-chloro-N-[(5-chlorothiophen-2-yl)methyl]-5-ethoxy-N-ethyl-4-hydroxybenzamide |
|---|---|
| PubChem CID | 112811138 |
| Molecular Formula | C16H17Cl2NO3S |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 3-chloro-N-[(5-chlorothiophen-2-yl)methyl]-5-ethoxy-N-ethyl-4-hydroxybenzamide |
| SMILES | CCOc1cc(C(=O)N(CC)Cc2ccc(Cl)s2)cc(Cl)c1O |
| InChI | InChI=1S/C16H17Cl2NO3S/c1-3-19(9-11-5-6-14(18)23-11)16(21)10-7-12(17)15(20)13(8-10)22-4-2/h5-8,20H,3-4,9H2,1-2H3 |
| InChIKey | HCUGWSJHVFYAEQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |