C15H14Cl2FNO2S — CID 55397253
2-(3-chloro-4-fluorophenoxy)-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylacetamide (PubChem CID 55397253) has the molecular formula C15H14Cl2FNO2S and a molecular weight of 362.25 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenoxy)-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylacetamide.
| Compound Name | 2-(3-chloro-4-fluorophenoxy)-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 55397253 |
| Molecular Formula | C15H14Cl2FNO2S |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 2-(3-chloro-4-fluorophenoxy)-N-[(5-chlorothiophen-2-yl)methyl]-N-ethylacetamide |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)COc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H14Cl2FNO2S/c1-2-19(8-11-4-6-14(17)22-11)15(20)9-21-10-3-5-13(18)12(16)7-10/h3-7H,2,8-9H2,1H3 |
| InChIKey | LTCPSUMNXYFALD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |