C14H13ClF2N2OS — CID 79757915
3-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2,6-difluorobenzamide (PubChem CID 79757915) has the molecular formula C14H13ClF2N2OS and a molecular weight of 330.79 g/mol. Its IUPAC name is 3-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2,6-difluorobenzamide.
| Compound Name | 3-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 79757915 |
| Molecular Formula | C14H13ClF2N2OS |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 3-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2,6-difluorobenzamide |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)c1c(F)ccc(N)c1F |
| InChI | InChI=1S/C14H13ClF2N2OS/c1-2-19(7-8-3-6-11(15)21-8)14(20)12-9(16)4-5-10(18)13(12)17/h3-6H,2,7,18H2,1H3 |
| InChIKey | BNAWABISJDABRI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|