C18H20ClNO4S — CID 55360432
N-[(5-chlorothiophen-2-yl)methyl]-3,4,5-trimethoxy-N-prop-2-enylbenzamide (PubChem CID 55360432) has the molecular formula C18H20ClNO4S and a molecular weight of 381.88 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-3,4,5-trimethoxy-N-prop-2-enylbenzamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-3,4,5-trimethoxy-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 55360432 |
| Molecular Formula | C18H20ClNO4S |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-3,4,5-trimethoxy-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H20ClNO4S/c1-5-8-20(11-13-6-7-16(19)25-13)18(21)12-9-14(22-2)17(24-4)15(10-12)23-3/h5-7,9-10H,1,8,11H2,2-4H3 |
| InChIKey | JVQSLRSOFMPTPJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|