C13H18ClNOS — CID 60646090
N-[(5-chlorothiophen-2-yl)methyl]-2,2-dimethyl-N-prop-2-enylpropanamide (PubChem CID 60646090) has the molecular formula C13H18ClNOS and a molecular weight of 271.81 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2,2-dimethyl-N-prop-2-enylpropanamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2,2-dimethyl-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 60646090 |
| Molecular Formula | C13H18ClNOS |
| Molecular Weight | 271.81 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2,2-dimethyl-N-prop-2-enylpropanamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C13H18ClNOS/c1-5-8-15(12(16)13(2,3)4)9-10-6-7-11(14)17-10/h5-7H,1,8-9H2,2-4H3 |
| InChIKey | CIAACZQHXHKMKZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.81 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|