C11H16Cl2N2OS — CID 119688617
N-[(5-chlorothiophen-2-yl)methyl]-2-(methylamino)-N-prop-2-enylacetamide;hydrochloride (PubChem CID 119688617) has the molecular formula C11H16Cl2N2OS and a molecular weight of 295.24 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2-(methylamino)-N-prop-2-enylacetamide;hydrochloride.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2-(methylamino)-N-prop-2-enylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119688617 |
| Molecular Formula | C11H16Cl2N2OS |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2-(methylamino)-N-prop-2-enylacetamide;hydrochloride |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)CNC.Cl |
| InChI | InChI=1S/C11H15ClN2OS.ClH/c1-3-6-14(11(15)7-13-2)8-9-4-5-10(12)16-9;/h3-5,13H,1,6-8H2,2H3;1H |
| InChIKey | CWUDGKFTKIHTHJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|