C10H10ClF2NOS — CID 103601269
N-[(5-chlorothiophen-2-yl)methyl]-2,2-difluoro-N-prop-2-enylacetamide (PubChem CID 103601269) has the molecular formula C10H10ClF2NOS and a molecular weight of 265.71 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2,2-difluoro-N-prop-2-enylacetamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2,2-difluoro-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 103601269 |
| Molecular Formula | C10H10ClF2NOS |
| Molecular Weight | 265.71 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2,2-difluoro-N-prop-2-enylacetamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)C(F)F |
| InChI | InChI=1S/C10H10ClF2NOS/c1-2-5-14(10(15)9(12)13)6-7-3-4-8(11)16-7/h2-4,9H,1,5-6H2 |
| InChIKey | YOJLEXOKJLHXKM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.71 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|