C12H11ClN2OS2 — CID 62045486
N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-1,3-thiazole-4-carboxamide (PubChem CID 62045486) has the molecular formula C12H11ClN2OS2 and a molecular weight of 298.82 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62045486 |
| Molecular Formula | C12H11ClN2OS2 |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-1,3-thiazole-4-carboxamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)c1cscn1 |
| InChI | InChI=1S/C12H11ClN2OS2/c1-2-5-15(6-9-3-4-11(13)18-9)12(16)10-7-17-8-14-10/h2-4,7-8H,1,5-6H2 |
| InChIKey | SXTDGMJHZHIQQV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|