C14H16ClN3OS2 — CID 66390052
2-(1-aminoethyl)-N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-1,3-thiazole-4-carboxamide (PubChem CID 66390052) has the molecular formula C14H16ClN3OS2 and a molecular weight of 341.89 g/mol. Its IUPAC name is 2-(1-aminoethyl)-N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1-aminoethyl)-N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 66390052 |
| Molecular Formula | C14H16ClN3OS2 |
| Molecular Weight | 341.89 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2-(1-aminoethyl)-N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-1,3-thiazole-4-carboxamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)c1csc(C(C)N)n1 |
| InChI | InChI=1S/C14H16ClN3OS2/c1-3-6-18(7-10-4-5-12(15)21-10)14(19)11-8-20-13(17-11)9(2)16/h3-5,8-9H,1,6-7,16H2,2H3 |
| InChIKey | SDVDCHASQGIVLV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.89 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|