C13H17Cl2NOS — CID 55246582
3-chloro-N-[(5-chlorothiophen-2-yl)methyl]-2,2-dimethyl-N-prop-2-enylpropanamide (PubChem CID 55246582) has the molecular formula C13H17Cl2NOS and a molecular weight of 306.26 g/mol. Its IUPAC name is 3-chloro-N-[(5-chlorothiophen-2-yl)methyl]-2,2-dimethyl-N-prop-2-enylpropanamide.
| Compound Name | 3-chloro-N-[(5-chlorothiophen-2-yl)methyl]-2,2-dimethyl-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 55246582 |
| Molecular Formula | C13H17Cl2NOS |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3-chloro-N-[(5-chlorothiophen-2-yl)methyl]-2,2-dimethyl-N-prop-2-enylpropanamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C13H17Cl2NOS/c1-4-7-16(12(17)13(2,3)9-14)8-10-5-6-11(15)18-10/h4-6H,1,7-9H2,2-3H3 |
| InChIKey | CDBPTEZSYXPSHO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|