C16H20ClNO3S — CID 120672288
4-[(5-chlorothiophen-2-yl)methyl-prop-2-enylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 120672288) has the molecular formula C16H20ClNO3S and a molecular weight of 341.86 g/mol. Its IUPAC name is 4-[(5-chlorothiophen-2-yl)methyl-prop-2-enylcarbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(5-chlorothiophen-2-yl)methyl-prop-2-enylcarbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120672288 |
| Molecular Formula | C16H20ClNO3S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 4-[(5-chlorothiophen-2-yl)methyl-prop-2-enylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C16H20ClNO3S/c1-2-9-18(10-13-7-8-14(17)22-13)15(19)11-3-5-12(6-4-11)16(20)21/h2,7-8,11-12H,1,3-6,9-10H2,(H,20,21) |
| InChIKey | IDPSIAJGBGPZQZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|