C15H21ClN2OS — CID 120618136
(2S,4S)-N-[(5-chlorothiophen-2-yl)methyl]-2-methyl-N-prop-2-enylpiperidine-4-carboxamide (PubChem CID 120618136) has the molecular formula C15H21ClN2OS and a molecular weight of 312.87 g/mol. Its IUPAC name is (2S,4S)-N-[(5-chlorothiophen-2-yl)methyl]-2-methyl-N-prop-2-enylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-[(5-chlorothiophen-2-yl)methyl]-2-methyl-N-prop-2-enylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120618136 |
| Molecular Formula | C15H21ClN2OS |
| Molecular Weight | 312.87 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (2S,4S)-N-[(5-chlorothiophen-2-yl)methyl]-2-methyl-N-prop-2-enylpiperidine-4-carboxamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)[C@H]1CCN[C@@H](C)C1 |
| InChI | InChI=1S/C15H21ClN2OS/c1-3-8-18(10-13-4-5-14(16)20-13)15(19)12-6-7-17-11(2)9-12/h3-5,11-12,17H,1,6-10H2,2H3/t11-,12-/m0/s1 |
| InChIKey | BGOJLYASUVWBKN-RYUDHWBXSA-N |
| XLogP | 3.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.87 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|