C15H22Cl2N2OS — CID 120618135
(2S,4S)-N-[(5-chlorothiophen-2-yl)methyl]-2-methyl-N-prop-2-enylpiperidine-4-carboxamide;hydrochloride (PubChem CID 120618135) has the molecular formula C15H22Cl2N2OS and a molecular weight of 349.33 g/mol. Its IUPAC name is (2S,4S)-N-[(5-chlorothiophen-2-yl)methyl]-2-methyl-N-prop-2-enylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | (2S,4S)-N-[(5-chlorothiophen-2-yl)methyl]-2-methyl-N-prop-2-enylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120618135 |
| Molecular Formula | C15H22Cl2N2OS |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | (2S,4S)-N-[(5-chlorothiophen-2-yl)methyl]-2-methyl-N-prop-2-enylpiperidine-4-carboxamide;hydrochloride |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)[C@H]1CCN[C@@H](C)C1.Cl |
| InChI | InChI=1S/C15H21ClN2OS.ClH/c1-3-8-18(10-13-4-5-14(16)20-13)15(19)12-6-7-17-11(2)9-12;/h3-5,11-12,17H,1,6-10H2,2H3;1H/t11-,12-;/m0./s1 |
| InChIKey | GWJWSINGIPAOQO-FXMYHANSSA-N |
| XLogP | 3.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|