C17H24ClFN2O — CID 120625240
(2S,4S)-N-[(2-fluorophenyl)methyl]-2-methyl-N-prop-2-enylpiperidine-4-carboxamide;hydrochloride (PubChem CID 120625240) has the molecular formula C17H24ClFN2O and a molecular weight of 326.84 g/mol. Its IUPAC name is (2S,4S)-N-[(2-fluorophenyl)methyl]-2-methyl-N-prop-2-enylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | (2S,4S)-N-[(2-fluorophenyl)methyl]-2-methyl-N-prop-2-enylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120625240 |
| Molecular Formula | C17H24ClFN2O |
| Molecular Weight | 326.84 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (2S,4S)-N-[(2-fluorophenyl)methyl]-2-methyl-N-prop-2-enylpiperidine-4-carboxamide;hydrochloride |
| SMILES | C=CCN(Cc1ccccc1F)C(=O)[C@H]1CCN[C@@H](C)C1.Cl |
| InChI | InChI=1S/C17H23FN2O.ClH/c1-3-10-20(12-15-6-4-5-7-16(15)18)17(21)14-8-9-19-13(2)11-14;/h3-7,13-14,19H,1,8-12H2,2H3;1H/t13-,14-;/m0./s1 |
| InChIKey | BIPIHYWCBDRICH-IODNYQNNSA-N |
| XLogP | 3.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.84 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|