C12H14FNO — CID 84571244
N-[(2-fluorophenyl)methyl]-N-prop-2-enylacetamide (PubChem CID 84571244) has the molecular formula C12H14FNO and a molecular weight of 207.25 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-N-prop-2-enylacetamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 84571244 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(Cc1ccccc1F)C(C)=O |
| InChI | InChI=1S/C12H14FNO/c1-3-8-14(10(2)15)9-11-6-4-5-7-12(11)13/h3-7H,1,8-9H2,2H3 |
| InChIKey | BMLCRORXXSYZOC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|