C22H26FNO4 — CID 55921283
N-[(2-fluorophenyl)methyl]-N-prop-2-enyl-3-(2,3,4-trimethoxyphenyl)propanamide (PubChem CID 55921283) has the molecular formula C22H26FNO4 and a molecular weight of 387.45 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-N-prop-2-enyl-3-(2,3,4-trimethoxyphenyl)propanamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-N-prop-2-enyl-3-(2,3,4-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 55921283 |
| Molecular Formula | C22H26FNO4 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-N-prop-2-enyl-3-(2,3,4-trimethoxyphenyl)propanamide |
| SMILES | C=CCN(Cc1ccccc1F)C(=O)CCc1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C22H26FNO4/c1-5-14-24(15-17-8-6-7-9-18(17)23)20(25)13-11-16-10-12-19(26-2)22(28-4)21(16)27-3/h5-10,12H,1,11,13-15H2,2-4H3 |
| InChIKey | SRBKKCJGFGKIEQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|