C17H25FN2O — CID 119746541
7-amino-N-[(2-fluorophenyl)methyl]-N-prop-2-enylheptanamide (PubChem CID 119746541) has the molecular formula C17H25FN2O and a molecular weight of 292.40 g/mol. Its IUPAC name is 7-amino-N-[(2-fluorophenyl)methyl]-N-prop-2-enylheptanamide.
| Compound Name | 7-amino-N-[(2-fluorophenyl)methyl]-N-prop-2-enylheptanamide |
|---|---|
| PubChem CID | 119746541 |
| Molecular Formula | C17H25FN2O |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 7-amino-N-[(2-fluorophenyl)methyl]-N-prop-2-enylheptanamide |
| SMILES | C=CCN(Cc1ccccc1F)C(=O)CCCCCCN |
| InChI | InChI=1S/C17H25FN2O/c1-2-13-20(14-15-9-6-7-10-16(15)18)17(21)11-5-3-4-8-12-19/h2,6-7,9-10H,1,3-5,8,11-14,19H2 |
| InChIKey | HCRZDDIGEKJQCJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|