C16H18FN5OS — CID 51089353
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[(2-fluorophenyl)methyl]-N-prop-2-enylacetamide (PubChem CID 51089353) has the molecular formula C16H18FN5OS and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[(2-fluorophenyl)methyl]-N-prop-2-enylacetamide.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[(2-fluorophenyl)methyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 51089353 |
| Molecular Formula | C16H18FN5OS |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[(2-fluorophenyl)methyl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(Cc1ccccc1F)C(=O)CSc1nnnn1C1CC1 |
| InChI | InChI=1S/C16H18FN5OS/c1-2-9-21(10-12-5-3-4-6-14(12)17)15(23)11-24-16-18-19-20-22(16)13-7-8-13/h2-6,13H,1,7-11H2 |
| InChIKey | DQSSSRGNQAXARC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|